ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
723-89-7 1-phenylisatin |
|
| název výrobku | 1-phenylisatin |
| Anglický název | 1-phenylisatin;1H-Indole-2,3-dione, 1-phenyl- (9CI);1-Phenyl-1H-indole-2,3-dione;1-Phenyl-indole-2,3-dione;1-Phenylisatin;5-21-10-00247 (Beilstein Handbook Reference);BRN 0164531;NSC 100013;Indole-2,3-dione, 1-phenyl- |
| Molekulární vzorec | C14H9NO2 |
| Molekulová hmotnost | 223.2268 |
| InChl | InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
| Registrační číslo CAS | 723-89-7 |
| Molekulární struktura | ![]() |
| Hustota | 1.338g/cm3 |
| Bod tání | 138-140℃ |
| Bod varu | 388.8°C at 760 mmHg |
| Index lomu | 1.667 |
| Bod vzplanutí | 182.6°C |
| Tlak par | 2.99E-06mmHg at 25°C |
| Bezpečnostní Popis | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |