ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
723-89-7 1-phenylisatin |
|
| 상품명칭 | 1-phenylisatin |
| 영문 이름 | 1-phenylisatin;1H-Indole-2,3-dione, 1-phenyl- (9CI);1-Phenyl-1H-indole-2,3-dione;1-Phenyl-indole-2,3-dione;1-Phenylisatin;5-21-10-00247 (Beilstein Handbook Reference);BRN 0164531;NSC 100013;Indole-2,3-dione, 1-phenyl- |
| 분자식 | C14H9NO2 |
| 분자량 | 223.2268 |
| InChI | InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
| cas번호 | 723-89-7 |
| 분자 구조 | ![]() |
| 밀도 | 1.338g/cm3 |
| 녹는 점 | 138-140℃ |
| 비등점 | 388.8°C at 760 mmHg |
| 굴절 지수 | 1.667 |
| 인화점 | 182.6°C |
| 증기압 | 2.99E-06mmHg at 25°C |
| 보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |