ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-28-5 Trans,Trans-Farnesol |
|
| Produkt-Name | Trans,Trans-Farnesol |
| Englischer Name | Trans,Trans-Farnesol;trans,trans-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol;3,7,11-trimethyldodeca-2,6,10-trien-1-ol;(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol;(E,E)-Farnesol |
| Molekulare Formel | C15H26O |
| Molecular Weight | 222.3663 |
| InChl | InChI=1/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
| CAS Registry Number | 106-28-5 |
| EINECS | 225-004-1 |
| Molecular Structure | ![]() |
| Dichte | 0.875g/cm3 |
| Siedepunkt | 283.4°C at 760 mmHg |
| Brechungsindex | 1.485 |
| Flammpunkt | 112.5°C |
| Dampfdruck | 0.00037mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |