ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-28-5 Trans,Trans-Farnesol |
|
| Naam product | Trans,Trans-Farnesol |
| Engelse naam | Trans,Trans-Farnesol;trans,trans-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol;3,7,11-trimethyldodeca-2,6,10-trien-1-ol;(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol;(E,E)-Farnesol |
| MF | C15H26O |
| Molecuulgewicht | 222.3663 |
| InChI | InChI=1/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
| CAS-nummer | 106-28-5 |
| EINECS | 225-004-1 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.875g/cm3 |
| Kookpunt | 283.4°C at 760 mmHg |
| Brekingsindex | 1.485 |
| Vlampunt | 112.5°C |
| Dampdruk | 0.00037mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |