ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
115664-55-6 3-Nitrofluoranthen-6-ol |
|
| Produkt-Name | 3-Nitrofluoranthen-6-ol |
| Synonyme | CCRIS 3449; 4-Nitrofluoranthen-1-ol; |
| Englischer Name | 3-Nitrofluoranthen-6-ol;CCRIS 3449;4-nitrofluoranthen-1-ol |
| Molekulare Formel | C16H9NO3 |
| Molecular Weight | 263.2476 |
| InChl | InChI=1/C16H9NO3/c18-14-8-6-12-13(17(19)20)7-5-11-9-3-1-2-4-10(9)16(14)15(11)12/h1-8,18H |
| CAS Registry Number | 115664-55-6 |
| Molecular Structure | ![]() |
| Dichte | 1.528g/cm3 |
| Siedepunkt | 509.7°C at 760 mmHg |
| Brechungsindex | 1.912 |
| Flammpunkt | 218.3°C |
| Dampfdruck | 5.2E-11mmHg at 25°C |
| MSDS | |