ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
115664-55-6 3-nitrofluorantheen-6-ol |
|
| Naam product | 3-nitrofluorantheen-6-ol |
| Synoniemen | CCRIS 3449; 4-nitrofluorantheen-1-ol; |
| Engelse naam | 3-Nitrofluoranthen-6-ol;CCRIS 3449;4-nitrofluoranthen-1-ol |
| MF | C16H9NO3 |
| Molecuulgewicht | 263.2476 |
| InChI | InChI=1/C16H9NO3/c18-14-8-6-12-13(17(19)20)7-5-11-9-3-1-2-4-10(9)16(14)15(11)12/h1-8,18H |
| CAS-nummer | 115664-55-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.528g/cm3 |
| Kookpunt | 509.7°C at 760 mmHg |
| Brekingsindex | 1.912 |
| Vlampunt | 218.3°C |
| Dampdruk | 5.2E-11mmHg at 25°C |
| MSDS | |