ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
142501-42-6 3-Oxo-3-(2,4,5-trifluorphenyl)propanitril |
|
| Produkt-Name | 3-Oxo-3-(2,4,5-trifluorphenyl)propanitril |
| Englischer Name | 3-oxo-3-(2,4,5-trifluorophenyl)propanenitrile; |
| Molekulare Formel | C9H4F3NO |
| Molecular Weight | 199.1294 |
| InChl | InChI=1/C9H4F3NO/c10-6-4-8(12)7(11)3-5(6)9(14)1-2-13/h3-4H,1H2 |
| CAS Registry Number | 142501-42-6 |
| Molecular Structure | ![]() |
| Dichte | 1.387g/cm3 |
| Siedepunkt | 312.4°C at 760 mmHg |
| Brechungsindex | 1.48 |
| Flammpunkt | 142.7°C |
| Dampfdruck | 0.00053mmHg at 25°C |
| MSDS | |