ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
142501-42-6 3-osso-3-(2,4,5-trifluorofenil)propannitrile |
|
| Nome del prodotto | 3-osso-3-(2,4,5-trifluorofenil)propannitrile |
| Nome inglese | 3-oxo-3-(2,4,5-trifluorophenyl)propanenitrile; |
| Formula molecolare | C9H4F3NO |
| Peso Molecolare | 199.1294 |
| InChI | InChI=1/C9H4F3NO/c10-6-4-8(12)7(11)3-5(6)9(14)1-2-13/h3-4H,1H2 |
| Numero CAS | 142501-42-6 |
| Struttura molecolare | ![]() |
| Densità | 1.387g/cm3 |
| Punto di ebollizione | 312.4°C at 760 mmHg |
| Indice di rifrazione | 1.48 |
| Punto d'infiammabilità | 142.7°C |
| Pressione di vapore | 0.00053mmHg at 25°C |
| MSDS | |