ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
147123-47-5 3-Aminothiophene-2-carboxamide |
|
Produkt-Name | 3-Aminothiophene-2-carboxamide |
Englischer Name | 3-Aminothiophene-2-carboxamide; |
Molekulare Formel | C5H6N2OS |
Molecular Weight | 142.1789 |
InChl | InChI=1/C5H6N2OS/c6-3-1-2-9-4(3)5(7)8/h1-2H,6H2,(H2,7,8) |
CAS Registry Number | 147123-47-5 |
Molecular Structure | ![]() |
Dichte | 1.423g/cm3 |
Schmelzpunkt | 120℃ |
Siedepunkt | 368.7°C at 760 mmHg |
Brechungsindex | 1.681 |
Flammpunkt | 176.8°C |
Dampfdruck | 1.25E-05mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |