ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
147123-47-5 3-Aminothiophene-2-carboxamide |
|
produktnavn | 3-Aminothiophene-2-carboxamide |
Engelsk navn | 3-Aminothiophene-2-carboxamide; |
Molekylær Formel | C5H6N2OS |
Molekylvekt | 142.1789 |
InChI | InChI=1/C5H6N2OS/c6-3-1-2-9-4(3)5(7)8/h1-2H,6H2,(H2,7,8) |
CAS-nummer | 147123-47-5 |
Molecular Structure | ![]() |
Tetthet | 1.423g/cm3 |
Smeltepunkt | 120℃ |
Kokepunkt | 368.7°C at 760 mmHg |
Brytningsindeks | 1.681 |
Flammepunktet | 176.8°C |
Damptrykk | 1.25E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |