ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175136-78-4 2,4-Dichlor-1-(2-iodphenoxy)benzol |
|
Produkt-Name | 2,4-Dichlor-1-(2-iodphenoxy)benzol |
Englischer Name | 2,4-dichloro-1-(2-iodophenoxy)benzene; |
Molekulare Formel | C12H7Cl2IO |
Molecular Weight | 364.9939 |
InChl | InChI=1/C12H7Cl2IO/c13-8-5-6-11(9(14)7-8)16-12-4-2-1-3-10(12)15/h1-7H |
CAS Registry Number | 175136-78-4 |
Molecular Structure | ![]() |
Dichte | 1.771g/cm3 |
Siedepunkt | 345.1°C at 760 mmHg |
Brechungsindex | 1.652 |
Flammpunkt | 162.5°C |
Dampfdruck | 0.000125mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |