ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175136-78-4 2,4-dichloro-1-(2-jodofenoksy)benzen |
|
Nazwa produktu: | 2,4-dichloro-1-(2-jodofenoksy)benzen |
Angielska nazwa | 2,4-dichloro-1-(2-iodophenoxy)benzene; |
MF | C12H7Cl2IO |
Masie cząsteczkowej | 364.9939 |
InChI | InChI=1/C12H7Cl2IO/c13-8-5-6-11(9(14)7-8)16-12-4-2-1-3-10(12)15/h1-7H |
Nr CAS | 175136-78-4 |
Struktury molekularnej | ![]() |
Gęstość | 1.771g/cm3 |
Temperatura wrzenia | 345.1°C at 760 mmHg |
Współczynnik załamania | 1.652 |
Temperatura zapłonu | 162.5°C |
Ciśnienie pary | 0.000125mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |