ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
202667-44-5 2-Methyl-3,5,6,7-tetrahydro-s-indacen-1(2H)-on |
|
| Produkt-Name | 2-Methyl-3,5,6,7-tetrahydro-s-indacen-1(2H)-on |
| Synonyme | 2-Methyl-3,5,6,7-tetrahydro-s-indacen-1(2H)-on; s-Indacin-1(2H)-on, 3,5,6,7-Tetrahydro-2-methyl-; 2-Methyl-2,3,6,7-tetrahydros-indacen-1(5H)-on; 3,5,6,7-Tetrahydro-2-methyl-s-indacen-1(2H)-on; |
| Englischer Name | 2-methyl-3,5,6,7-tetrahydro-s-indacen-1(2H)-one;2-Methyl-3,5,6,7-tetrahydro-s-indacen-1(2H)-one;s-indacen-1(2H)-one, 3,5,6,7-tetrahydro-2-methyl-;2-methyl-2,3,6,7-tetrahydros-indacen-1(5H)-one;3,5,6,7-Tetrahydro-2-Methyl-S-Indacen-1(2H)-One |
| Molekulare Formel | C13H14O |
| Molecular Weight | 186.2497 |
| InChl | InChI=1/C13H14O/c1-8-5-11-6-9-3-2-4-10(9)7-12(11)13(8)14/h6-8H,2-5H2,1H3 |
| CAS Registry Number | 202667-44-5 |
| Molecular Structure | ![]() |
| Dichte | 1.135g/cm3 |
| Siedepunkt | 328.681°C at 760 mmHg |
| Brechungsindex | 1.591 |
| Flammpunkt | 142.446°C |
| Dampfdruck | 0mmHg at 25°C |
| MSDS | |