ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
202667-44-5 2-metil-3,5,6,7-tetraidro-s-indacen-1(2H)-one |
|
| Nome del prodotto | 2-metil-3,5,6,7-tetraidro-s-indacen-1(2H)-one |
| Sinonimi | 2-metil-3,5,6,7-tetraidro-s-indacen-1(2H)-one; s-indacen-1(2H)-one, 3,5,6,7-tetraidro-2-metil-; 2-metil-2,3,6,7-tetraidros-indacen-1(5H)-one; 3,5,6,7-tetraidro-2-metil-S-indacen-1(2H)-one; |
| Nome inglese | 2-methyl-3,5,6,7-tetrahydro-s-indacen-1(2H)-one;2-Methyl-3,5,6,7-tetrahydro-s-indacen-1(2H)-one;s-indacen-1(2H)-one, 3,5,6,7-tetrahydro-2-methyl-;2-methyl-2,3,6,7-tetrahydros-indacen-1(5H)-one;3,5,6,7-Tetrahydro-2-Methyl-S-Indacen-1(2H)-One |
| Formula molecolare | C13H14O |
| Peso Molecolare | 186.2497 |
| InChI | InChI=1/C13H14O/c1-8-5-11-6-9-3-2-4-10(9)7-12(11)13(8)14/h6-8H,2-5H2,1H3 |
| Numero CAS | 202667-44-5 |
| Struttura molecolare | ![]() |
| Densità | 1.135g/cm3 |
| Punto di ebollizione | 328.681°C at 760 mmHg |
| Indice di rifrazione | 1.591 |
| Punto d'infiammabilità | 142.446°C |
| Pressione di vapore | 0mmHg at 25°C |
| MSDS | |