ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
205748-03-4 4-(4-Nitrobenzyloxy)acetophenone |
|
| Produkt-Name | 4-(4-Nitrobenzyloxy)acetophenone |
| Englischer Name | 4-(4-Nitrobenzyloxy)acetophenone;4'-(4-nitrobenzyloxy)acetophenone;1-{4-[(4-nitrobenzyl)oxy]phenyl}ethanone |
| Molekulare Formel | C15H13NO4 |
| Molecular Weight | 271.268 |
| InChl | InChI=1/C15H13NO4/c1-11(17)13-4-8-15(9-5-13)20-10-12-2-6-14(7-3-12)16(18)19/h2-9H,10H2,1H3 |
| CAS Registry Number | 205748-03-4 |
| Molecular Structure | ![]() |
| Dichte | 1.247g/cm3 |
| Siedepunkt | 456.3°C at 760 mmHg |
| Brechungsindex | 1.595 |
| Flammpunkt | 203°C |
| Dampfdruck | 1.63E-08mmHg at 25°C |
| Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |