ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
205748-03-4 4-(4-Nitrobenzyloxy)acetophenone |
|
| Nome del prodotto | 4-(4-Nitrobenzyloxy)acetophenone |
| Nome inglese | 4-(4-Nitrobenzyloxy)acetophenone;4'-(4-nitrobenzyloxy)acetophenone;1-{4-[(4-nitrobenzyl)oxy]phenyl}ethanone |
| Formula molecolare | C15H13NO4 |
| Peso Molecolare | 271.268 |
| InChI | InChI=1/C15H13NO4/c1-11(17)13-4-8-15(9-5-13)20-10-12-2-6-14(7-3-12)16(18)19/h2-9H,10H2,1H3 |
| Numero CAS | 205748-03-4 |
| Struttura molecolare | ![]() |
| Densità | 1.247g/cm3 |
| Punto di ebollizione | 456.3°C at 760 mmHg |
| Indice di rifrazione | 1.595 |
| Punto d'infiammabilità | 203°C |
| Pressione di vapore | 1.63E-08mmHg at 25°C |
| Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |