ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22482-43-5 1,3-dichloro-2-(2-nitrovinyl)benzene |
|
Produkt-Name | 1,3-dichloro-2-(2-nitrovinyl)benzene |
Englischer Name | 1,3-dichloro-2-(2-nitrovinyl)benzene;2,6-Dichloro-ω-nitrostyrene;2,6-Dichloro-omega-nitrostyrene;1,3-dichloro-2-(2-nitroethenyl)benzene |
Molekulare Formel | C8H5Cl2NO2 |
Molecular Weight | 218.0368 |
InChl | InChI=1/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H |
CAS Registry Number | 22482-43-5 |
Molecular Structure | ![]() |
Dichte | 1.447g/cm3 |
Schmelzpunkt | 62℃ |
Siedepunkt | 330.6°C at 760 mmHg |
Brechungsindex | 1.626 |
Flammpunkt | 153.7°C |
Dampfdruck | 0.000316mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |