ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22482-43-5 1,3-dichloro-2-(2-nitrovinyl)benzene |
|
Nazwa produktu: | 1,3-dichloro-2-(2-nitrovinyl)benzene |
Angielska nazwa | 1,3-dichloro-2-(2-nitrovinyl)benzene;2,6-Dichloro-ω-nitrostyrene;2,6-Dichloro-omega-nitrostyrene;1,3-dichloro-2-(2-nitroethenyl)benzene |
MF | C8H5Cl2NO2 |
Masie cząsteczkowej | 218.0368 |
InChI | InChI=1/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H |
Nr CAS | 22482-43-5 |
Struktury molekularnej | ![]() |
Gęstość | 1.447g/cm3 |
Temperatura topnienia | 62℃ |
Temperatura wrzenia | 330.6°C at 760 mmHg |
Współczynnik załamania | 1.626 |
Temperatura zapłonu | 153.7°C |
Ciśnienie pary | 0.000316mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |