Chemindex > 263015-85-6
DE ▼
263015-85-6 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide |
|
| Produkt-Name | 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide |
| Englischer Name | 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide; |
| Molekulare Formel | C11H13N3O2S |
| Molecular Weight | 251.3048 |
| InChl | InChI=1/C11H13N3O2S/c12-10(14-15)7-16-9-3-1-8(2-4-9)11-13-5-6-17-11/h1-4,15H,5-7H2,(H2,12,14) |
| CAS Registry Number | 263015-85-6 |
| Molecular Structure | ![263015-85-6 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide](https://images-a.chemnet.com/suppliers/chembase/291/29139.gif "263015-85-6 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide") |
| Dichte | 1.41g/cm3 |
| Schmelzpunkt | 200℃ |
| Siedepunkt | 505.8°C at 760 mmHg |
| Brechungsindex | 1.67 |
| Flammpunkt | 259.7°C |
| Dampfdruck | 4.7E-11mmHg at 25°C |
| Gefahrensymbole |  Xi##Irritant:; |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 263015-85-6 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 