ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
263015-85-6 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide |
|
Nama produk | 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide |
Nama Inggeris | 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide; |
MF | C11H13N3O2S |
Berat Molekul | 251.3048 |
InChI | InChI=1/C11H13N3O2S/c12-10(14-15)7-16-9-3-1-8(2-4-9)11-13-5-6-17-11/h1-4,15H,5-7H2,(H2,12,14) |
CAS NO | 263015-85-6 |
Struktur Molekul | ![]() |
Kepadatan | 1.41g/cm3 |
Titik lebur | 200℃ |
Titik didih | 505.8°C at 760 mmHg |
Indeks bias | 1.67 |
Titik nyala | 259.7°C |
Tekanan wap | 4.7E-11mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |