ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2719-21-3 4-Acetamido-acetophenone |
|
Produkt-Name | 4-Acetamido-acetophenone |
Englischer Name | 4-Acetamido-acetophenone;4-Acetylacetanilide~N,4-Diacetylaniline;4-Acetamidoacetophenone;N-(4-acetylphenyl)acetamide |
Molekulare Formel | C10H11NO2 |
Molecular Weight | 177.1998 |
InChl | InChI=1/C10H11NO2/c1-7(12)9-3-5-10(6-4-9)11-8(2)13/h3-6H,1-2H3,(H,11,13) |
CAS Registry Number | 2719-21-3 |
EINECS | 220-320-6 |
Molecular Structure | ![]() |
Dichte | 1.15g/cm3 |
Schmelzpunkt | 164-166℃ |
Siedepunkt | 390.3°C at 760 mmHg |
Brechungsindex | 1.57 |
Flammpunkt | 177.3°C |
Dampfdruck | 2.67E-06mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |