ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2719-21-3 4-Acetamido-acetophenone |
|
| Naam product | 4-Acetamido-acetophenone |
| Engelse naam | 4-Acetamido-acetophenone;4-Acetylacetanilide~N,4-Diacetylaniline;4-Acetamidoacetophenone;N-(4-acetylphenyl)acetamide |
| MF | C10H11NO2 |
| Molecuulgewicht | 177.1998 |
| InChI | InChI=1/C10H11NO2/c1-7(12)9-3-5-10(6-4-9)11-8(2)13/h3-6H,1-2H3,(H,11,13) |
| CAS-nummer | 2719-21-3 |
| EINECS | 220-320-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.15g/cm3 |
| Smeltpunt | 164-166℃ |
| Kookpunt | 390.3°C at 760 mmHg |
| Brekingsindex | 1.57 |
| Vlampunt | 177.3°C |
| Dampdruk | 2.67E-06mmHg at 25°C |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |