ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
286-62-4 Cyclooctene oxide |
|
| Produkt-Name | Cyclooctene oxide |
| Englischer Name | Cyclooctene oxide;9-Oxabicyclo[6.1.0]nonane;Epoxycyclooctane~2-Oxabicyclo[6.1.0]nonane;Epoxycyclooctane;(1R,8S)-9-oxabicyclo[6.1.0]nonane;(1R,8R)-9-oxabicyclo[6.1.0]nonane;(1S,8S)-9-oxabicyclo[6.1.0]nonane |
| Molekulare Formel | C8H14O |
| Molecular Weight | 126.1962 |
| InChl | InChI=1/C8H14O/c1-2-4-6-8-7(9-8)5-3-1/h7-8H,1-6H2/t7-,8-/m0/s1 |
| CAS Registry Number | 286-62-4 |
| EINECS | 206-010-3 |
| Molecular Structure | ![]() |
| Dichte | 0.958g/cm3 |
| Schmelzpunkt | 53-56℃ |
| Siedepunkt | 189.3°C at 760 mmHg |
| Brechungsindex | 1.466 |
| Flammpunkt | 56.1°C |
| Dampfdruck | 0.793mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |