ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
286-62-4 Cyclooctene oxide |
|
| Naam product | Cyclooctene oxide |
| Engelse naam | Cyclooctene oxide;9-Oxabicyclo[6.1.0]nonane;Epoxycyclooctane~2-Oxabicyclo[6.1.0]nonane;Epoxycyclooctane;(1R,8S)-9-oxabicyclo[6.1.0]nonane;(1R,8R)-9-oxabicyclo[6.1.0]nonane;(1S,8S)-9-oxabicyclo[6.1.0]nonane |
| MF | C8H14O |
| Molecuulgewicht | 126.1962 |
| InChI | InChI=1/C8H14O/c1-2-4-6-8-7(9-8)5-3-1/h7-8H,1-6H2/t7-,8-/m0/s1 |
| CAS-nummer | 286-62-4 |
| EINECS | 206-010-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.958g/cm3 |
| Smeltpunt | 53-56℃ |
| Kookpunt | 189.3°C at 760 mmHg |
| Brekingsindex | 1.466 |
| Vlampunt | 56.1°C |
| Dampdruk | 0.793mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |