ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
287922-40-1 4-Amino-2-(4-methylphenyl)-6-(methylthio)pyrimidin-5-carbonitril |
|
Produkt-Name | 4-Amino-2-(4-methylphenyl)-6-(methylthio)pyrimidin-5-carbonitril |
Synonyme | 4-Amino-2-(4-methylphenyl)-6-(methylsulfanyl)pyrimidin-5-carbonitril; |
Englischer Name | 4-amino-2-(4-methylphenyl)-6-(methylthio)pyrimidine-5-carbonitrile;4-amino-2-(4-methylphenyl)-6-(methylsulfanyl)pyrimidine-5-carbonitrile |
Molekulare Formel | C13H12N4S |
Molecular Weight | 256.3262 |
InChl | InChI=1/C13H12N4S/c1-8-3-5-9(6-4-8)12-16-11(15)10(7-14)13(17-12)18-2/h3-6H,1-2H3,(H2,15,16,17) |
CAS Registry Number | 287922-40-1 |
Molecular Structure | ![]() |
Dichte | 1.31g/cm3 |
Schmelzpunkt | 213℃ |
Siedepunkt | 364.9°C at 760 mmHg |
Brechungsindex | 1.665 |
Flammpunkt | 174.5°C |
Dampfdruck | 1.63E-05mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |