ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
287922-40-1 4-amino-2-(4-methylphenyl)-6-(methylthio)pyrimidine-5-carbonitrile |
|
Nama produk | 4-amino-2-(4-methylphenyl)-6-(methylthio)pyrimidine-5-carbonitrile |
Sinonim | 4-amino-2-(4-methylphenyl)-6-(methylsulfanyl)pyrimidine-5-carbonitrile; |
Nama Inggeris | 4-amino-2-(4-methylphenyl)-6-(methylthio)pyrimidine-5-carbonitrile;4-amino-2-(4-methylphenyl)-6-(methylsulfanyl)pyrimidine-5-carbonitrile |
MF | C13H12N4S |
Berat Molekul | 256.3262 |
InChI | InChI=1/C13H12N4S/c1-8-3-5-9(6-4-8)12-16-11(15)10(7-14)13(17-12)18-2/h3-6H,1-2H3,(H2,15,16,17) |
CAS NO | 287922-40-1 |
Struktur Molekul | ![]() |
Kepadatan | 1.31g/cm3 |
Titik lebur | 213℃ |
Titik didih | 364.9°C at 760 mmHg |
Indeks bias | 1.665 |
Titik nyala | 174.5°C |
Tekanan wap | 1.63E-05mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Penerangan | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |