ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
321309-24-4 1H-Indol-7-carbohydrazid |
|
Produkt-Name | 1H-Indol-7-carbohydrazid |
Englischer Name | 1H-indole-7-carbohydrazide; |
Molekulare Formel | C9H9N3O |
Molecular Weight | 175.1873 |
InChl | InChI=1/C9H9N3O/c10-12-9(13)7-3-1-2-6-4-5-11-8(6)7/h1-5,11H,10H2,(H,12,13) |
CAS Registry Number | 321309-24-4 |
Molecular Structure | ![]() |
Dichte | 1.353g/cm3 |
Schmelzpunkt | 177℃ |
Brechungsindex | 1.719 |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |