ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
321309-24-4 1H-indole-7-karbohidrat |
|
Nama produk | 1H-indole-7-karbohidrat |
Nama Inggeris | 1H-indole-7-carbohydrazide; |
MF | C9H9N3O |
Berat Molekul | 175.1873 |
InChI | InChI=1/C9H9N3O/c10-12-9(13)7-3-1-2-6-4-5-11-8(6)7/h1-5,11H,10H2,(H,12,13) |
CAS NO | 321309-24-4 |
Struktur Molekul | ![]() |
Kepadatan | 1.353g/cm3 |
Titik lebur | 177℃ |
Indeks bias | 1.719 |
Cinta bahaya | |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |