Chemindex > 359-40-0
DE ▼
359-40-0 oxalyl fluoride |
|
| Produkt-Name | oxalyl fluoride |
| Englischer Name | oxalyl fluoride;Ethanedioyl difluoride;4-02-00-01853 (Beilstein Handbook Reference);BRN 1743349;Difluorid kyseliny stavelove;Difluorid kyseliny stavelove [Czech];Oxalyl difluoride;Oxalyl fluoride;TL 108 |
| Molekulare Formel | C2F2O2 |
| Molecular Weight | 94.017 |
| InChl | InChI=1/C2F2O2/c3-1(5)2(4)6 |
| CAS Registry Number | 359-40-0 |
| EINECS | 206-630-4 |
| Molecular Structure |  |
| Dichte | 1.409g/cm3 |
| Siedepunkt | 85.6°C at 760 mmHg |
| Brechungsindex | 1.28 |
| Flammpunkt | 21.9°C |
| Dampfdruck | 68.9mmHg at 25°C |
| Risk Codes | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R34##Causes burns.||R37##Irritating to respiratory system.:; |
| Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 359-40-0 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 