ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
359-40-0 oxalyl fluoride |
|
उत्पाद का नाम | oxalyl fluoride |
अंग्रेज | oxalyl fluoride;Ethanedioyl difluoride;4-02-00-01853 (Beilstein Handbook Reference);BRN 1743349;Difluorid kyseliny stavelove;Difluorid kyseliny stavelove [Czech];Oxalyl difluoride;Oxalyl fluoride;TL 108 |
आणविक फार्मूला | C2F2O2 |
आण्विक वजन | 94.017 |
InChI | InChI=1/C2F2O2/c3-1(5)2(4)6 |
कैस रजिस्टी संख्या | 359-40-0 |
EINECS | 206-630-4 |
आणविक संरचना | ![]() |
घनत्व | 1.409g/cm3 |
उबलने का समय | 85.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.28 |
फ्लैश प्वाइंट | 21.9°C |
वाष्प का दबाव | 68.9mmHg at 25°C |
खतरे के कोड | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R34##Causes burns.||R37##Irritating to respiratory system.:; |
सुरक्षा विवरण | S23##Do not inhale gas/fumes/vapour/spray.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |