ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
36192-63-9 2-Amino-4'-methylbenzophenone |
|
Produkt-Name | 2-Amino-4'-methylbenzophenone |
Englischer Name | 2-Amino-4'-methylbenzophenone;2-Amino-4'-methylbenzophenone m;(2-aminophenyl)(4-methylphenyl)methanone |
Molekulare Formel | C14H13NO |
Molecular Weight | 211.2591 |
InChl | InChI=1/C14H13NO/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15/h2-9H,15H2,1H3 |
CAS Registry Number | 36192-63-9 |
EINECS | 252-905-7 |
Molecular Structure | ![]() |
Dichte | 1.135g/cm3 |
Schmelzpunkt | 91-94℃ |
Siedepunkt | 407.1°C at 760 mmHg |
Brechungsindex | 1.616 |
Flammpunkt | 200°C |
Dampfdruck | 7.75E-07mmHg at 25°C |
Gefahrensymbole | |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |