ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
36192-63-9 2-Amino-4'-methylbenzophenone |
|
produktnavn | 2-Amino-4'-methylbenzophenone |
Engelsk navn | 2-Amino-4'-methylbenzophenone;2-Amino-4'-methylbenzophenone m;(2-aminophenyl)(4-methylphenyl)methanone |
Molekylær Formel | C14H13NO |
Molekylvekt | 211.2591 |
InChI | InChI=1/C14H13NO/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15/h2-9H,15H2,1H3 |
CAS-nummer | 36192-63-9 |
EINECS | 252-905-7 |
Molecular Structure | ![]() |
Tetthet | 1.135g/cm3 |
Smeltepunkt | 91-94℃ |
Kokepunkt | 407.1°C at 760 mmHg |
Brytningsindeks | 1.616 |
Flammepunktet | 200°C |
Damptrykk | 7.75E-07mmHg at 25°C |
Hazard symboler | |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |