ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37592-72-6 p-Hexylacetophenone |
|
Produkt-Name | p-Hexylacetophenone |
Englischer Name | p-Hexylacetophenone;Hexylacetophenone;4-n-Hexylacetophenone;1-(4-hexylphenyl)ethanone |
Molekulare Formel | C14H20O |
Molecular Weight | 204.308 |
InChl | InChI=1/C14H20O/c1-3-4-5-6-7-13-8-10-14(11-9-13)12(2)15/h8-11H,3-7H2,1-2H3 |
CAS Registry Number | 37592-72-6 |
Molecular Structure | ![]() |
Dichte | 0.929g/cm3 |
Siedepunkt | 308.7°C at 760 mmHg |
Brechungsindex | 1.497 |
Flammpunkt | 128.2°C |
Dampfdruck | 0.000668mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |