ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37592-72-6 p-Hexylacetophenone |
|
상품명칭 | p-Hexylacetophenone |
영문 이름 | p-Hexylacetophenone;Hexylacetophenone;4-n-Hexylacetophenone;1-(4-hexylphenyl)ethanone |
분자식 | C14H20O |
분자량 | 204.308 |
InChI | InChI=1/C14H20O/c1-3-4-5-6-7-13-8-10-14(11-9-13)12(2)15/h8-11H,3-7H2,1-2H3 |
cas번호 | 37592-72-6 |
분자 구조 | ![]() |
밀도 | 0.929g/cm3 |
비등점 | 308.7°C at 760 mmHg |
굴절 지수 | 1.497 |
인화점 | 128.2°C |
증기압 | 0.000668mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |