ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
399-36-0 2',4'-Difluoroacetanilide |
|
Produkt-Name | 2',4'-Difluoroacetanilide |
Englischer Name | 2',4'-Difluoroacetanilide;2,4-Difluoroacetanilide;N-(2,4-difluorophenyl)acetamide |
Molekulare Formel | C8H7F2NO |
Molecular Weight | 171.1441 |
InChl | InChI=1/C8H7F2NO/c1-5(12)11-8-3-2-6(9)4-7(8)10/h2-4H,1H3,(H,11,12) |
CAS Registry Number | 399-36-0 |
Molecular Structure | ![]() |
Dichte | 1.307g/cm3 |
Siedepunkt | 276.8°C at 760 mmHg |
Brechungsindex | 1.531 |
Flammpunkt | 121.2°C |
Dampfdruck | 0.0047mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |