ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
399-36-0 2',4'-Difluoroacetanilide |
|
| Nome del prodotto | 2',4'-Difluoroacetanilide |
| Nome inglese | 2',4'-Difluoroacetanilide;2,4-Difluoroacetanilide;N-(2,4-difluorophenyl)acetamide |
| Formula molecolare | C8H7F2NO |
| Peso Molecolare | 171.1441 |
| InChI | InChI=1/C8H7F2NO/c1-5(12)11-8-3-2-6(9)4-7(8)10/h2-4H,1H3,(H,11,12) |
| Numero CAS | 399-36-0 |
| Struttura molecolare | ![]() |
| Densità | 1.307g/cm3 |
| Punto di ebollizione | 276.8°C at 760 mmHg |
| Indice di rifrazione | 1.531 |
| Punto d'infiammabilità | 121.2°C |
| Pressione di vapore | 0.0047mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |