ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
454-29-5 DL-Homocysteine |
|
| Produkt-Name | DL-Homocysteine |
| Englischer Name | DL-Homocysteine;DL-Homocysteine 2-Amino-4-mercaptobuyric acid;homocysteine;D-homocysteine |
| Molekulare Formel | C4H9NO2S |
| Molecular Weight | 135.1848 |
| InChl | InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1 |
| CAS Registry Number | 454-29-5 |
| EINECS | 207-222-9 |
| Molecular Structure | ![]() |
| Dichte | 1.259g/cm3 |
| Schmelzpunkt | 232-233℃ |
| Siedepunkt | 299.7°C at 760 mmHg |
| Brechungsindex | 1.537 |
| Flammpunkt | 135°C |
| Dampfdruck | 0.000278mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |