ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
454-29-5 DL-Homocysteine |
|
| termék neve | DL-Homocysteine |
| Angol név | DL-Homocysteine;DL-Homocysteine 2-Amino-4-mercaptobuyric acid;homocysteine;D-homocysteine |
| MF | C4H9NO2S |
| Molekulatömeg | 135.1848 |
| InChI | InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1 |
| CAS-szám | 454-29-5 |
| EINECS | 207-222-9 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.259g/cm3 |
| Olvadáspont | 232-233℃ |
| Forráspont | 299.7°C at 760 mmHg |
| Törésmutató | 1.537 |
| Gyulladáspont | 135°C |
| Gőznyomás | 0.000278mmHg at 25°C |
| Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |