ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
458-92-4 alpha,alpha-Difluoroanisole |
|
| Produkt-Name | alpha,alpha-Difluoroanisole |
| Englischer Name | alpha,alpha-Difluoroanisole;(Difluoromethoxy)benzene |
| Molekulare Formel | C7H6F2O |
| Molecular Weight | 144.1187 |
| InChl | InChI=1/C7H6F2O/c8-7(9)10-6-4-2-1-3-5-6/h1-5,7H |
| CAS Registry Number | 458-92-4 |
| EINECS | 207-283-1 |
| Molecular Structure | ![]() |
| Dichte | 1.155g/cm3 |
| Siedepunkt | 138°C at 760 mmHg |
| Brechungsindex | 1.445 |
| Flammpunkt | 43.1°C |
| Dampfdruck | 8.52mmHg at 25°C |
| Risk Codes | R10##Flammable.:; |
| Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |