ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
458-92-4 alpha,alpha-Difluoroanisole |
|
| Nome del prodotto | alpha,alpha-Difluoroanisole |
| Nome inglese | alpha,alpha-Difluoroanisole;(Difluoromethoxy)benzene |
| Formula molecolare | C7H6F2O |
| Peso Molecolare | 144.1187 |
| InChI | InChI=1/C7H6F2O/c8-7(9)10-6-4-2-1-3-5-6/h1-5,7H |
| Numero CAS | 458-92-4 |
| EINECS | 207-283-1 |
| Struttura molecolare | ![]() |
| Densità | 1.155g/cm3 |
| Punto di ebollizione | 138°C at 760 mmHg |
| Indice di rifrazione | 1.445 |
| Punto d'infiammabilità | 43.1°C |
| Pressione di vapore | 8.52mmHg at 25°C |
| Codici di Rischio | R10##Flammable.:; |
| Sicurezza Descrizione | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |