ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
474334-89-9 Methyl-3-(4-methylpiperazin-1-yl)benzoat |
|
| Produkt-Name | Methyl-3-(4-methylpiperazin-1-yl)benzoat |
| Englischer Name | methyl 3-(4-methylpiperazin-1-yl)benzoate; |
| Molekulare Formel | C13H18N2O2 |
| Molecular Weight | 234.2942 |
| InChl | InChI=1/C13H18N2O2/c1-14-6-8-15(9-7-14)12-5-3-4-11(10-12)13(16)17-2/h3-5,10H,6-9H2,1-2H3 |
| CAS Registry Number | 474334-89-9 |
| Molecular Structure | ![]() |
| Dichte | 1.112g/cm3 |
| Siedepunkt | 362.4°C at 760 mmHg |
| Brechungsindex | 1.544 |
| Flammpunkt | 173°C |
| Dampfdruck | 1.94E-05mmHg at 25°C |
| MSDS | |