ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
474334-89-9 methyl-3-(4-methylpiperazine-1-yl)benzoaat |
|
| Naam product | methyl-3-(4-methylpiperazine-1-yl)benzoaat |
| Engelse naam | methyl 3-(4-methylpiperazin-1-yl)benzoate; |
| MF | C13H18N2O2 |
| Molecuulgewicht | 234.2942 |
| InChI | InChI=1/C13H18N2O2/c1-14-6-8-15(9-7-14)12-5-3-4-11(10-12)13(16)17-2/h3-5,10H,6-9H2,1-2H3 |
| CAS-nummer | 474334-89-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.112g/cm3 |
| Kookpunt | 362.4°C at 760 mmHg |
| Brekingsindex | 1.544 |
| Vlampunt | 173°C |
| Dampdruk | 1.94E-05mmHg at 25°C |
| MSDS | |