ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
490028-20-1 methyl (3R,4R,5R,6R)-3,4,5-triacetoxy-6-(3-hydroxy-5-iodo-phenoxy)tetrahydropyran-2-carboxylate |
|
| Produkt-Name | methyl (3R,4R,5R,6R)-3,4,5-triacetoxy-6-(3-hydroxy-5-iodo-phenoxy)tetrahydropyran-2-carboxylate |
| Englischer Name | methyl (3R,4R,5R,6R)-3,4,5-triacetoxy-6-(3-hydroxy-5-iodo-phenoxy)tetrahydropyran-2-carboxylate; |
| Molekulare Formel | C19H21IO11 |
| Molecular Weight | 552.2679 |
| InChl | InChI=1/C19H21IO11/c1-8(21)27-14-15(28-9(2)22)17(29-10(3)23)19(31-16(14)18(25)26-4)30-13-6-11(20)5-12(24)7-13/h5-7,14-17,19,24H,1-4H3/t14-,15-,16?,17-,19+/m1/s1 |
| CAS Registry Number | 490028-20-1 |
| Molecular Structure | ![]() |
| Dichte | 1.686g/cm3 |
| Siedepunkt | 583.299°C at 760 mmHg |
| Brechungsindex | 1.587 |
| Flammpunkt | 306.568°C |
| Dampfdruck | 0mmHg at 25°C |
| MSDS | |