ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
490028-20-1 methyl (3R,4R,5R,6R)-3,4,5-triacetoxy-6-(3-hydroxy-5-iodo-phenoxy)tetrahydropyran-2-carboxylate |
|
| اسم المنتج | methyl (3R,4R,5R,6R)-3,4,5-triacetoxy-6-(3-hydroxy-5-iodo-phenoxy)tetrahydropyran-2-carboxylate |
| الاسم بالانجليزية | methyl (3R,4R,5R,6R)-3,4,5-triacetoxy-6-(3-hydroxy-5-iodo-phenoxy)tetrahydropyran-2-carboxylate; |
| الصيغة الجزيئية | C19H21IO11 |
| الوزن الجزيئي الغرامي | 552.2679 |
| InChI | InChI=1/C19H21IO11/c1-8(21)27-14-15(28-9(2)22)17(29-10(3)23)19(31-16(14)18(25)26-4)30-13-6-11(20)5-12(24)7-13/h5-7,14-17,19,24H,1-4H3/t14-,15-,16?,17-,19+/m1/s1 |
| إستراتيجية المساعدة القطرية | 490028-20-1 |
| بنية جزيئية | ![]() |
| كثافة | 1.686g/cm3 |
| نقطة الغليان | 583.299°C at 760 mmHg |
| معامل الإنكسار | 1.587 |
| نقطة الوميض | 306.568°C |
| ضغط البخار | 0mmHg at 25°C |
| MSDS | |