ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50907-23-8 5-(4-Bromophenyl)-1H-tetrazole |
|
| Produkt-Name | 5-(4-Bromophenyl)-1H-tetrazole |
| Englischer Name | 5-(4-Bromophenyl)-1H-tetrazole;5-(4-bromophenyl)-2H-tetrazole;5-(4-bromophenyl)tetrazol-1-ido |
| Molekulare Formel | C7H4BrN4 |
| Molecular Weight | 224.038 |
| InChl | InChI=1/C7H4BrN4/c8-6-3-1-5(2-4-6)7-9-11-12-10-7/h1-4H/q-1 |
| CAS Registry Number | 50907-23-8 |
| Molecular Structure | ![]() |
| Siedepunkt | 374.6°C at 760 mmHg |
| Flammpunkt | 180.3°C |
| Dampfdruck | 8.27E-06mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |