ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50907-23-8 5-(4-Bromophenyl)-1H-tetrazole |
|
| Nome del prodotto | 5-(4-Bromophenyl)-1H-tetrazole |
| Nome inglese | 5-(4-Bromophenyl)-1H-tetrazole;5-(4-bromophenyl)-2H-tetrazole;5-(4-bromophenyl)tetrazol-1-ido |
| Formula molecolare | C7H4BrN4 |
| Peso Molecolare | 224.038 |
| InChI | InChI=1/C7H4BrN4/c8-6-3-1-5(2-4-6)7-9-11-12-10-7/h1-4H/q-1 |
| Numero CAS | 50907-23-8 |
| Struttura molecolare | ![]() |
| Punto di ebollizione | 374.6°C at 760 mmHg |
| Punto d'infiammabilità | 180.3°C |
| Pressione di vapore | 8.27E-06mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |