ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-85-9 butane-2,3-diol |
|
| Produkt-Name | butane-2,3-diol |
| Englischer Name | butane-2,3-diol;2,3-Butanediol;2,3-Dihydroxybutane;2,3-Butanediol, mixture of DL and meso;2,3-butylene glycol;(2R,3S)-butane-2,3-diol |
| Molekulare Formel | C4H10O2 |
| Molecular Weight | 90.121 |
| InChl | InChI=1/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3 |
| CAS Registry Number | 513-85-9;123513-85-9 |
| EINECS | 208-173-6 |
| Molecular Structure | ![]() |
| Dichte | 0.997g/cm3 |
| Schmelzpunkt | 25℃ |
| Siedepunkt | 180.7°C at 760 mmHg |
| Brechungsindex | 1.434 |
| Flammpunkt | 85°C |
| Wasserlöslichkeit | SOLUBLE |
| Dampfdruck | 0.26mmHg at 25°C |
| Safety Beschreibung | S24/25:; |
| MSDS | |