ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-85-9 butane-2,3-diol |
|
| Nome del prodotto | butane-2,3-diol |
| Nome inglese | butane-2,3-diol;2,3-Butanediol;2,3-Dihydroxybutane;2,3-Butanediol, mixture of DL and meso;2,3-butylene glycol;(2R,3S)-butane-2,3-diol |
| Formula molecolare | C4H10O2 |
| Peso Molecolare | 90.121 |
| InChI | InChI=1/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3 |
| Numero CAS | 513-85-9;123513-85-9 |
| EINECS | 208-173-6 |
| Struttura molecolare | ![]() |
| Densità | 0.997g/cm3 |
| Punto di fusione | 25℃ |
| Punto di ebollizione | 180.7°C at 760 mmHg |
| Indice di rifrazione | 1.434 |
| Punto d'infiammabilità | 85°C |
| Solubilità in acqua | SOLUBLE |
| Pressione di vapore | 0.26mmHg at 25°C |
| Sicurezza Descrizione | S24/25:; |
| MSDS | |