ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51593-69-2 6-Hydroxychromen-3-carboxaldehyd |
|
| Produkt-Name | 6-Hydroxychromen-3-carboxaldehyd |
| Synonyme | 2H-Chromen-3-carbaldehyd; |
| Englischer Name | 6-Hydroxychromene-3-carboxaldehyde;2H-Chromene-3-carbaldehyde |
| Molekulare Formel | C10H8O2 |
| Molecular Weight | 160.1693 |
| InChl | InChI=1/C10H8O2/c11-6-8-5-9-3-1-2-4-10(9)12-7-8/h1-6H,7H2 |
| CAS Registry Number | 51593-69-2 |
| Molecular Structure | ![]() |
| Dichte | 1.28g/cm3 |
| Siedepunkt | 300.451°C at 760 mmHg |
| Brechungsindex | 1.661 |
| Flammpunkt | 145.387°C |
| Dampfdruck | 0.001mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |