ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51593-69-2 6-hydroxychromeen-3-carboxaldehyde |
|
| Naam product | 6-hydroxychromeen-3-carboxaldehyde |
| Synoniemen | 2H-chroom-3-carbaldehyde; |
| Engelse naam | 6-Hydroxychromene-3-carboxaldehyde;2H-Chromene-3-carbaldehyde |
| MF | C10H8O2 |
| Molecuulgewicht | 160.1693 |
| InChI | InChI=1/C10H8O2/c11-6-8-5-9-3-1-2-4-10(9)12-7-8/h1-6H,7H2 |
| CAS-nummer | 51593-69-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.28g/cm3 |
| Kookpunt | 300.451°C at 760 mmHg |
| Brekingsindex | 1.661 |
| Vlampunt | 145.387°C |
| Dampdruk | 0.001mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |